ChemNet > CAS > 206559-44-6 2-(5-Bromo-2-methoxyphenyl)ethylamine hydrobromide
206559-44-6 2-(5-Bromo-2-methoxyphenyl)ethylamine hydrobromide
| product Name |
2-(5-Bromo-2-methoxyphenyl)ethylamine hydrobromide |
| CAS No |
206559-44-6 |
| Synonyms |
5-Bromo-2-methoxyphenethylamine hydrobromide; 2-(5-bromo-2-methoxyphenyl)ethanaminium bromide |
| Molecular Formula |
C9H13Br2NO |
| Molecular Weight |
311.0136 |
| InChI |
InChI=1/C9H12BrNO.BrH/c1-12-9-3-2-8(10)6-7(9)4-5-11;/h2-3,6H,4-5,11H2,1H3;1H |
| Molecular Structure |
|
| Boiling point |
296.9°C at 760 mmHg |
| Flash point |
133.3°C |
| Vapour Pressur |
0.0014mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
