ChemNet > CAS > 206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate
206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate
| product Name |
2,4,6-(trifluorophenyl)isothiocyanate |
| CAS No |
206761-91-3 |
| Synonyms |
2,4,6-Trifluorophenyl isothiocyanate; 1,3,5-trifluoro-2-isothiocyanatobenzene |
| Molecular Formula |
C7H2F3NS |
| Molecular Weight |
189.1577 |
| InChI |
InChI=1/C7H2F3NS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| Molecular Structure |
|
| Density |
1.36g/cm3 |
| Boiling point |
213.9°C at 760 mmHg |
| Refractive index |
1.52 |
| Flash point |
83.1°C |
| Vapour Pressur |
0.234mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
