ChemNet > CAS > 20780-76-1 5-Iodoisatin
20780-76-1 5-Iodoisatin
| product Name |
5-Iodoisatin |
| CAS No |
20780-76-1 |
| Synonyms |
5-Iodo-1H-indole-2,3-dione; NSC 92515; Iodoisatin, 5- |
| Molecular Formula |
C8H4INO2 |
| Molecular Weight |
273.0273 |
| InChI |
InChI=1/C8H4INO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| EINECS |
244-035-1 |
| Molecular Structure |
|
| Density |
2.106g/cm3 |
| Melting point |
276-278℃ |
| Refractive index |
1.704 |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
