ChemNet > CAS > 208173-22-2 2,3,6-trifluoroacetophenone
208173-22-2 2,3,6-trifluoroacetophenone
| product Name |
2,3,6-trifluoroacetophenone |
| CAS No |
208173-22-2 |
| Synonyms |
2',3',6'-trifluoroacetophenone; 1-(2,3,6-trifluorophenyl)ethanone |
| Molecular Formula |
C8H5F3O |
| Molecular Weight |
174.1199 |
| InChI |
InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
| Molecular Structure |
|
| Density |
1.303g/cm3 |
| Boiling point |
187.2°C at 760 mmHg |
| Refractive index |
1.455 |
| Flash point |
65°C |
| Vapour Pressur |
0.637mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
