ChemNet > CAS > 20850-43-5 5-(chloromethyl)-1,3-benzodioxole
20850-43-5 5-(chloromethyl)-1,3-benzodioxole
| product Name |
5-(chloromethyl)-1,3-benzodioxole |
| CAS No |
20850-43-5 |
| Synonyms |
3,4-Methylenedioxybenzyl chloride; 5-chloro-1,3-benzodioxole; Piperonal chloride |
| Molecular Formula |
C7H5ClO2 |
| Molecular Weight |
156.5664 |
| InChI |
InChI=1/C7H5ClO2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4H2 |
| EINECS |
244-081-2 |
| Molecular Structure |
|
| Density |
1.39g/cm3 |
| Boiling point |
186°C at 760 mmHg |
| Refractive index |
1.577 |
| Flash point |
93.9°C |
| Vapour Pressur |
0.931mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
