20905-35-5 Trimethylene borate
product Name |
Trimethylene borate |
CAS No |
20905-35-5 |
Synonyms |
Boric acid cyclic ester with 1,3-propanediol; 2,2-[Propane-1,3-diylbis-(oxy)]-bis-1,3,2-dioxaborinane |
Molecular Formula |
C9H18B2O6 |
Molecular Weight |
243.8576 |
InChI |
InChI=1/C9H18B2O6/c1-4-12-10(13-5-1)16-8-3-9-17-11-14-6-2-7-15-11/h1-9H2 |
EINECS |
244-109-3 |
Molecular Structure |
|
Density |
1.1g/cm3 |
Boiling point |
239.9°C at 760 mmHg |
Refractive index |
1.428 |
Flash point |
98.9°C |
Vapour Pressur |
0.0605mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|