ChemNet > CAS > 2094-73-7 Ethyl adamantane-1-carboxylate
2094-73-7 Ethyl adamantane-1-carboxylate
| product Name |
Ethyl adamantane-1-carboxylate |
| CAS No |
2094-73-7 |
| Synonyms |
Adamantane-1-carboxylic acid ethyl ester; ethyl tricyclo[3.3.1.1~3,7~]decane-1-carboxylate |
| Molecular Formula |
C13H20O2 |
| Molecular Weight |
208.2967 |
| InChI |
InChI=1/C13H20O2/c1-2-15-12(14)13-6-9-3-10(7-13)5-11(4-9)8-13/h9-11H,2-8H2,1H3 |
| EINECS |
218-253-2 |
| Molecular Structure |
|
| Density |
1.106g/cm3 |
| Boiling point |
261.8°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
109.9°C |
| Vapour Pressur |
0.0113mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
