ChemNet > CAS > 2096-86-8 4-Methylphenylacetone
2096-86-8 4-Methylphenylacetone
| product Name |
4-Methylphenylacetone |
| CAS No |
2096-86-8 |
| Synonyms |
1-(4-methylphenyl)propan-2-one |
| Molecular Formula |
C10H12O |
| Molecular Weight |
148.2017 |
| InChI |
InChI=1/C10H12O/c1-8-3-5-10(6-4-8)7-9(2)11/h3-6H,7H2,1-2H3 |
| Molecular Structure |
|
| Density |
0.974g/cm3 |
| Boiling point |
223.1°C at 760 mmHg |
| Refractive index |
1.507 |
| Flash point |
97.1°C |
| Vapour Pressur |
0.0982mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
