ChemNet > CAS > 20972-36-5 trans-3-(4-methylbenzoyl)acrylic acid
20972-36-5 trans-3-(4-methylbenzoyl)acrylic acid
| product Name |
trans-3-(4-methylbenzoyl)acrylic acid |
| CAS No |
20972-36-5 |
| Synonyms |
3-(4-Methylbenzoyl)acrylic acid; (2E)-4-(4-methylphenyl)-4-oxobut-2-enoic acid |
| Molecular Formula |
C11H10O3 |
| Molecular Weight |
190.1953 |
| InChI |
InChI=1/C11H10O3/c1-8-2-4-9(5-3-8)10(12)6-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-6+ |
| Molecular Structure |
|
| Density |
1.2g/cm3 |
| Melting point |
138-140℃ |
| Boiling point |
361.8°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
186.8°C |
| Vapour Pressur |
7.24E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
