ChemNet > CAS > 2103-88-0 2-Mercapto-4-phenylthiazole
2103-88-0 2-Mercapto-4-phenylthiazole
| product Name |
2-Mercapto-4-phenylthiazole |
| CAS No |
2103-88-0 |
| Synonyms |
4-Phenyl-2-thiazolethiol; 4-phenyl-1,3-thiazole-2(3H)-thione |
| Molecular Formula |
C9H7NS2 |
| Molecular Weight |
193.2886 |
| InChI |
InChI=1/C9H7NS2/c11-9-10-8(6-12-9)7-4-2-1-3-5-7/h1-6H,(H,10,11) |
| EINECS |
218-274-7 |
| Molecular Structure |
|
| Density |
1.37g/cm3 |
| Boiling point |
333.1°C at 760 mmHg |
| Refractive index |
1.744 |
| Flash point |
155.2°C |
| Vapour Pressur |
0.00014mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
