ChemNet > CAS > 2107-77-9 7,8-Dihydroxy-4-methylcoumarin
2107-77-9 7,8-Dihydroxy-4-methylcoumarin
| product Name |
7,8-Dihydroxy-4-methylcoumarin |
| CAS No |
2107-77-9 |
| Synonyms |
4-Methyldaphnetin; 7,8-dihydroxy-4-methyl-2H-chromen-2-one |
| Molecular Formula |
C10H8O4 |
| Molecular Weight |
192.1681 |
| InChI |
InChI=1/C10H8O4/c1-5-4-8(12)14-10-6(5)2-3-7(11)9(10)13/h2-4,11,13H,1H3 |
| EINECS |
218-290-4 |
| Molecular Structure |
|
| Density |
1.456g/cm3 |
| Boiling point |
421.5°C at 760 mmHg |
| Refractive index |
1.651 |
| Flash point |
176°C |
| Vapour Pressur |
1.05E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
