ChemNet > CAS > 21160-95-2 N-methyldithiocarbamic acid, compound with methylamine (1:1)
21160-95-2 N-methyldithiocarbamic acid, compound with methylamine (1:1)
| product Name |
N-methyldithiocarbamic acid, compound with methylamine (1:1) |
| CAS No |
21160-95-2 |
| Synonyms |
Carbamodithioic acid, N-methyl-, compd. with methanamine (1:1); Methylammonium N-methyldithiocarbamate; Carbamodithioic acid, methyl-, compd. with methanamine (1:1); N-Methyldithiocarbamic acid, compound with methylamine (1:1); methylcarbamodithioic acid - methanamine (1:1) |
| Molecular Formula |
C3H10N2S2 |
| Molecular Weight |
138.2549 |
| InChI |
InChI=1/C2H5NS2.CH5N/c1-3-2(4)5;1-2/h1H3,(H2,3,4,5);2H2,1H3 |
| EINECS |
244-252-1 |
| Molecular Structure |
|
| Boiling point |
120.3°C at 760 mmHg |
| Flash point |
26.6°C |
| Vapour Pressur |
15.3mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
