ChemNet > CAS > 211943-12-3 5-(5-Bromo-2-thienyl)-1H-tetrazole
211943-12-3 5-(5-Bromo-2-thienyl)-1H-tetrazole
| product Name |
5-(5-Bromo-2-thienyl)-1H-tetrazole |
| CAS No |
211943-12-3 |
| Synonyms |
5-(5-bromothiophen-2-yl)-2H-tetrazole |
| Molecular Formula |
C5H3BrN4S |
| Molecular Weight |
231.0731 |
| InChI |
InChI=1/C5H3BrN4S/c6-4-2-1-3(11-4)5-7-9-10-8-5/h1-2H,(H,7,8,9,10) |
| Molecular Structure |
|
| Density |
1.952g/cm3 |
| Boiling point |
403.7°C at 760 mmHg |
| Refractive index |
1.697 |
| Flash point |
197.9°C |
| Vapour Pressur |
9.99E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
