ChemNet > CAS > 212755-83-4 2-(2-Pyridyl)malondialdehyde
212755-83-4 2-(2-Pyridyl)malondialdehyde
| product Name |
2-(2-Pyridyl)malondialdehyde |
| CAS No |
212755-83-4 |
| Synonyms |
pyridin-2-ylpropanedial; pyridin-2(1H)-ylidenepropanedial |
| Molecular Formula |
C8H7NO2 |
| Molecular Weight |
149.1467 |
| InChI |
InChI=1/C8H7NO2/c10-5-7(6-11)8-3-1-2-4-9-8/h1-6,9H |
| Molecular Structure |
|
| Density |
1.187g/cm3 |
| Boiling point |
298.7°C at 760 mmHg |
| Refractive index |
1.54 |
| Flash point |
142.4°C |
| Vapour Pressur |
0.00125mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|