ChemNet > CAS > 21278-86-4 2-(4-Pyridyl)thiazole-4-carboxylic acid
21278-86-4 2-(4-Pyridyl)thiazole-4-carboxylic acid
| product Name |
2-(4-Pyridyl)thiazole-4-carboxylic acid |
| CAS No |
21278-86-4 |
| Synonyms |
2-(4-Pyridyl)-1,3-thiazole-4-carboxylic acid; 2-(pyridin-4-yl)-1,3-thiazole-4-carboxylic acid; 2-pyridin-4-yl-1,3-thiazole-4-carboxylate |
| Molecular Formula |
C9H5N2O2S |
| Molecular Weight |
205.2137 |
| InChI |
InChI=1/C9H6N2O2S/c12-9(13)7-5-14-8(11-7)6-1-3-10-4-2-6/h1-5H,(H,12,13)/p-1 |
| Molecular Structure |
|
| Melting point |
300℃ |
| Boiling point |
469.3°C at 760 mmHg |
| Flash point |
237.6°C |
| Vapour Pressur |
1.31E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
