ChemNet > CAS > 21327-86-6 2-Chloro-6-Methylbenzoic Acid
21327-86-6 2-Chloro-6-Methylbenzoic Acid
| product Name |
2-Chloro-6-Methylbenzoic Acid |
| CAS No |
21327-86-6 |
| Synonyms |
6-Chloro-o-toluic acid (COOH=1); 6-Chloro-o-toluic acid; Benzoic acid,2-chloro-6-methyl-; 2-Choro-6-methyl-benzoic acid |
| Molecular Formula |
C8H7ClO2 |
| Molecular Weight |
170.593 |
| InChI |
InChI=1/C8H7ClO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Boiling point |
289.9°C at 760 mmHg |
| Refractive index |
1.573 |
| Flash point |
129.2°C |
| Vapour Pressur |
0.000984mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
