ChemNet > CAS > 2142-70-3 2-Iodoacetophenone
2142-70-3 2-Iodoacetophenone
| product Name |
2-Iodoacetophenone |
| CAS No |
2142-70-3 |
| Synonyms |
2'-iodoacetophenone; 1-(2-iodophenyl)ethanone; Iodoacetophenone, 2'- |
| Molecular Formula |
C8H7IO |
| Molecular Weight |
246.045 |
| InChI |
InChI=1/C8H7IO/c1-6(10)7-4-2-3-5-8(7)9/h2-5H,1H3 |
| Molecular Structure |
|
| Density |
1.72g/cm3 |
| Boiling point |
268.2°C at 760 mmHg |
| Refractive index |
1.603 |
| Flash point |
116°C |
| Vapour Pressur |
0.00779mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
