ChemNet > CAS > 2144-45-8 bisbenzyl peroxydicarbonate
2144-45-8 bisbenzyl peroxydicarbonate
| product Name |
bisbenzyl peroxydicarbonate |
| CAS No |
2144-45-8 |
| Synonyms |
Bisbenzyl peroxydicarbonate; Peroxydicarbonic acid, bis(phenylmethyl) ester; Dibenzyl peroxydicarbonate, >87% with water; Dibenzyl peroxydicarbonate, >87% with water [Forbidden]; 1,1'-[dioxybis(carbonyloxymethanediyl)]dibenzene |
| Molecular Formula |
C16H14O6 |
| Molecular Weight |
302.2788 |
| InChI |
InChI=1/C16H14O6/c17-15(19-11-13-7-3-1-4-8-13)21-22-16(18)20-12-14-9-5-2-6-10-14/h1-10H,11-12H2 |
| EINECS |
218-406-3 |
| Molecular Structure |
|
| Density |
1.282g/cm3 |
| Boiling point |
403.1°C at 760 mmHg |
| Refractive index |
1.563 |
| Flash point |
177.5°C |
| Vapour Pressur |
1.04E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
