ChemNet > CAS > 21463-31-0 (6R)-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine
21463-31-0 (6R)-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine
| product Name |
(6R)-6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine |
| CAS No |
21463-31-0 |
| Synonyms |
AMT HYDROCHLORIDE |
| Molecular Formula |
C5H10N2S |
| Molecular Weight |
130.2113 |
| InChI |
InChI=1/C5H10N2S/c1-4-2-3-7-5(6)8-4/h4H,2-3H2,1H3,(H2,6,7)/t4-/m1/s1 |
| Molecular Structure |
|
| Density |
1.31g/cm3 |
| Boiling point |
236.1°C at 760 mmHg |
| Refractive index |
1.636 |
| Flash point |
96.6°C |
| Vapour Pressur |
0.0482mmHg at 25°C |
|
Featured China Suppliers
| Contact |
peter |
| Telephone |
+86-21-38681880 |
| Email |
peter.xu@synmedia-chem.com |
| Address |
2/F, Block 3, East Area of Zhangjiang High Science and |