ChemNet > CAS > 214759-74-7 4-morpholinobenzylamine
214759-74-7 4-morpholinobenzylamine
| product Name |
4-morpholinobenzylamine |
| CAS No |
214759-74-7 |
| Synonyms |
(4-morpholinophenyl)methanamine; [4-(Morpholin-4-yl)benzyl]amine |
| Molecular Formula |
C11H16N2O |
| Molecular Weight |
192.2575 |
| InChI |
InChI=1/C11H16N2O/c12-9-10-1-3-11(4-2-10)13-5-7-14-8-6-13/h1-4H,5-9,12H2 |
| Molecular Structure |
|
| Density |
1.113g/cm3 |
| Melting point |
44℃ |
| Boiling point |
361.354°C at 760 mmHg |
| Refractive index |
1.568 |
| Flash point |
172.341°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
