ChemNet > CAS > 21510-43-0 2-(4-Bromophenyl)-5-phenyl-1,3,4-oxadiazole
21510-43-0 2-(4-Bromophenyl)-5-phenyl-1,3,4-oxadiazole
| product Name |
2-(4-Bromophenyl)-5-phenyl-1,3,4-oxadiazole |
| CAS No |
21510-43-0 |
| Molecular Formula |
C14H9BrN2O |
| Molecular Weight |
301.1381 |
| InChI |
InChI=1/C14H9BrN2O/c15-12-8-6-11(7-9-12)14-17-16-13(18-14)10-4-2-1-3-5-10/h1-9H |
| EINECS |
244-413-6 |
| Molecular Structure |
|
| Density |
1.465g/cm3 |
| Boiling point |
418.7°C at 760 mmHg |
| Refractive index |
1.614 |
| Flash point |
207°C |
| Vapour Pressur |
7.84E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
