ChemNet > CAS > 215453-51-3 7-Bromo-1-chloroisoquinoline
215453-51-3 7-Bromo-1-chloroisoquinoline
| product Name |
7-Bromo-1-chloroisoquinoline |
| CAS No |
215453-51-3 |
| Synonyms |
1-Chloro-7-bromoisoquinoline |
| Molecular Formula |
C9H5BrClN |
| Molecular Weight |
242.4997 |
| InChI |
InChI=1/C9H5BrClN/c10-7-2-1-6-3-4-12-9(11)8(6)5-7/h1-5H |
| Molecular Structure |
|
| Density |
1.673g/cm3 |
| Boiling point |
349.497°C at 760 mmHg |
| Refractive index |
1.68 |
| Flash point |
165.17°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
