ChemNet > CAS > 2155-60-4 dibutyl itaconate
2155-60-4 dibutyl itaconate
| product Name |
dibutyl itaconate |
| CAS No |
2155-60-4 |
| Synonyms |
Itaconic acid di-n-butyl ester; dibutyl 2-methylidenebutanedioate |
| Molecular Formula |
C13H22O4 |
| Molecular Weight |
242.3114 |
| InChI |
InChI=1/C13H22O4/c1-4-6-8-16-12(14)10-11(3)13(15)17-9-7-5-2/h3-10H2,1-2H3 |
| EINECS |
218-451-9 |
| Molecular Structure |
|
| Density |
0.989g/cm3 |
| Boiling point |
307.4°C at 760 mmHg |
| Refractive index |
1.446 |
| Flash point |
142.2°C |
| Vapour Pressur |
0.000728mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
