ChemNet > CAS > 215655-20-2 1-(2-chloro-6-fluorobenzyl)piperazine
215655-20-2 1-(2-chloro-6-fluorobenzyl)piperazine
| product Name |
1-(2-chloro-6-fluorobenzyl)piperazine |
| CAS No |
215655-20-2 |
| Molecular Formula |
C11H14ClFN2 |
| Molecular Weight |
228.6937 |
| InChI |
InChI=1/C11H14ClFN2/c12-10-2-1-3-11(13)9(10)8-15-6-4-14-5-7-15/h1-3,14H,4-8H2 |
| Molecular Structure |
|
| Density |
1.216g/cm3 |
| Boiling point |
299.7°C at 760 mmHg |
| Refractive index |
1.544 |
| Flash point |
135°C |
| Vapour Pressur |
0.00118mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
