ChemNet > CAS > 2157-52-0 9-Fluorenone Oxime
2157-52-0 9-Fluorenone Oxime
| product Name |
9-Fluorenone Oxime |
| CAS No |
2157-52-0 |
| Synonyms |
Fluorenone oxime; 4-07-00-01631 (Beilstein Handbook Reference); 9-Oximinofluorene; 9H-Fluoren-9-one, oxime; BRN 1871046; Fluorenone-9-oxime; NSC 1988; 9H-Fluoren-9-one oxime; Fluoren-9-one, oxime; N-hydroxy-9H-fluoren-9-imine |
| Molecular Formula |
C13H9NO |
| Molecular Weight |
195.2167 |
| InChI |
InChI=1/C13H9NO/c15-14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,15H |
| EINECS |
218-471-8 |
| Molecular Structure |
|
| Density |
1.23g/cm3 |
| Boiling point |
394.1°C at 760 mmHg |
| Refractive index |
1.663 |
| Flash point |
252.2°C |
| Vapour Pressur |
6.45E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
