ChemNet > CAS > 216394-04-6 trans-4-(beta-Nitrovinyl)benzeneboronic acid
216394-04-6 trans-4-(beta-Nitrovinyl)benzeneboronic acid
| product Name |
trans-4-(beta-Nitrovinyl)benzeneboronic acid |
| CAS No |
216394-04-6 |
| Synonyms |
4-Borono-trans-beta-nitrostyrene; trans-4-(beta-Nitrovinyl)phenylboronic acid; 4-[(E)-2-nitrovinyl]phenylboronic acid; {4-[(E)-2-nitroethenyl]phenyl}boronic acid; (E)-(4-(2-Nitrovinyl)phenyl)boronicacid |
| Molecular Formula |
C8H8BNO4 |
| Molecular Weight |
192.9644 |
| InChI |
InChI=1/C8H8BNO4/c11-9(12)8-3-1-7(2-4-8)5-6-10(13)14/h1-6,11-12H/b6-5+ |
| Molecular Structure |
|
| Density |
1.32g/cm3 |
| Boiling point |
412.6°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
203.3°C |
| Vapour Pressur |
1.51E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
