ChemNet > CAS > 216394-06-8 (1R,2R)-(-)-2-Benzyloxycyclohexylamine
216394-06-8 (1R,2R)-(-)-2-Benzyloxycyclohexylamine
| product Name |
(1R,2R)-(-)-2-Benzyloxycyclohexylamine |
| CAS No |
216394-06-8 |
| Synonyms |
(1R,2R)-(-)-1-Amino-2-benzyloxycyclohexane; (1R-trans)-(-)-2-(Phenylmethoxy)cyclohexanamine; (1R-trans)-2-(Phenylmethoxy)cyclohexaneamine; (1R,2R)-2-(benzyloxy)cyclohexanamine; (1R,2R)-2-phenylmethoxycyclohexan-1-amine |
| Molecular Formula |
C13H19NO |
| Molecular Weight |
205.2961 |
| InChI |
InChI=1/C13H19NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,14H2/t12-,13-/m1/s1 |
| Molecular Structure |
|
| Density |
1.039g/cm3 |
| Boiling point |
306.148°C at 760 mmHg |
| Refractive index |
1.545 |
| Flash point |
133.224°C |
| Vapour Pressur |
0.001mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
