ChemNet > CAS > 2164-33-2 2-Chloromethyl-1,4-benzodioxane
2164-33-2 2-Chloromethyl-1,4-benzodioxane
| product Name |
2-Chloromethyl-1,4-benzodioxane |
| CAS No |
2164-33-2 |
| Synonyms |
2-(Chloromethyl)-2,3-dihydro-1,4-benzodioxine; 2-(chloromethyl)-2,3-dihydrobenzo[b][1,4]dioxine;
|
| Molecular Formula |
C9H9ClO2 |
| Molecular Weight |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,5-6H2 |
| EINECS |
218-502-5 |
| Molecular Structure |
|
| Density |
1.224g/cm3 |
| Boiling point |
270.1°C at 760 mmHg |
| Refractive index |
1.529 |
| Flash point |
114.3°C |
| Vapour Pressur |
0.0116mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
