ChemNet > CAS > 2168-93-6 n-Butyl sulfoxide
2168-93-6 n-Butyl sulfoxide
| product Name |
n-Butyl sulfoxide |
| CAS No |
2168-93-6 |
| Synonyms |
Di-n-butyl sulfoxide; Di-n-butyl sulphoxide; n-Butyl sulphoxide; Dibutyl sulfoxide; Butane, 1,1'-sulfinylbis-; 1-(butylsulfinyl)butane |
| Molecular Formula |
C8H18OS |
| Molecular Weight |
162.2929 |
| InChI |
InChI=1/C8H18OS/c1-3-5-7-10(9)8-6-4-2/h3-8H2,1-2H3 |
| EINECS |
218-511-4 |
| Molecular Structure |
|
| Density |
0.954g/cm3 |
| Melting point |
30-35℃ |
| Boiling point |
250°C at 760 mmHg |
| Refractive index |
1.475 |
| Flash point |
121.4°C |
| Vapour Pressur |
0.0351mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
