ChemNet > CAS > 2169-87-1 2,3-Naphthalenedicarboxylic acid
2169-87-1 2,3-Naphthalenedicarboxylic acid
| product Name |
2,3-Naphthalenedicarboxylic acid |
| CAS No |
2169-87-1 |
| Synonyms |
NSC 16063; naphthalene-2,3-dicarboxylic acid; naphthalene-2,3-dicarboxylate |
| Molecular Formula |
C12H6O4 |
| Molecular Weight |
214.1747 |
| InChI |
InChI=1/C12H8O4/c13-11(14)9-5-7-3-1-2-4-8(7)6-10(9)12(15)16/h1-6H,(H,13,14)(H,15,16)/p-2 |
| EINECS |
218-517-7 |
| Molecular Structure |
|
| Melting point |
238-242℃ |
| Boiling point |
407.5°C at 760 mmHg |
| Flash point |
214.4°C |
| Vapour Pressur |
2.27E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
