ChemNet > CAS > 2170-09-4 N-Methyl-o-toluamide
2170-09-4 N-Methyl-o-toluamide
| product Name |
N-Methyl-o-toluamide |
| CAS No |
2170-09-4 |
| Synonyms |
N-Methyl-2-toluamide; AI3-30032; Benzamide, N,2-dimethyl-; N,2-dimethylbenzamide |
| Molecular Formula |
C9H11NO |
| Molecular Weight |
149.1897 |
| InChI |
InChI=1/C9H11NO/c1-7-5-3-4-6-8(7)9(11)10-2/h3-6H,1-2H3,(H,10,11) |
| EINECS |
218-519-8 |
| Molecular Structure |
|
| Density |
1.021g/cm3 |
| Melting point |
74-77℃ |
| Boiling point |
278.3°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
158.5°C |
| Vapour Pressur |
0.00429mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
