ChemNet > CAS > 2174-16-5 Triethanolamine salicylate
2174-16-5 Triethanolamine salicylate
| product Name |
Triethanolamine salicylate |
| CAS No |
2174-16-5 |
| Synonyms |
2-Hydroxybenzoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1); Benzoic acid, 2-hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1); TEA-Salicylate; Triethanolamine salicylate; Trolamine salicylate; Mobisyl; Triethanolamine salicylate; Salicylic acid, compound with 2,2',2''-nitrilotriethanol (1:1); 2-hydroxybenzoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| Molecular Formula |
C13H21NO6 |
| Molecular Weight |
287.3089 |
| InChI |
InChI=1/C7H6O3.C6H15NO3/c8-6-4-2-1-3-5(6)7(9)10;8-4-1-7(2-5-9)3-6-10/h1-4,8H,(H,9,10);8-10H,1-6H2 |
| EINECS |
218-531-3 |
| Molecular Structure |
|
| Boiling point |
335.4°C at 760 mmHg |
| Flash point |
185°C |
| Vapour Pressur |
8.38E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
