21854-95-5 2,2'-Dichlorobenzil
product Name |
2,2'-Dichlorobenzil |
CAS No |
21854-95-5 |
Synonyms |
2,2-Dichlorodibenzoyl; 1,2-bis(2-chlorophenyl)ethane-1,2-dione |
Molecular Formula |
C14H8Cl2O2 |
Molecular Weight |
279.1181 |
InChI |
InChI=1/C14H8Cl2O2/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16/h1-8H |
Molecular Structure |
|
Density |
1.366g/cm3 |
Boiling point |
426.9°C at 760 mmHg |
Refractive index |
1.612 |
Flash point |
180.2°C |
Vapour Pressur |
1.71E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|