ChemNet > CAS > 2187-07-7 DL-Alpha-Aminocaprylic acid
2187-07-7 DL-Alpha-Aminocaprylic acid
| product Name |
DL-Alpha-Aminocaprylic acid |
| CAS No |
2187-07-7 |
| Molecular Formula |
C8H17NO2 |
| Molecular Weight |
159.2261 |
| InChI |
InChI=1/C8H17NO2/c1-2-3-4-5-6-7(9)8(10)11/h7H,2-6,9H2,1H3,(H,10,11)/t7-/m1/s1 |
| EINECS |
218-579-5 |
| Molecular Structure |
|
| Density |
0.999g/cm3 |
| Melting point |
260℃ |
| Boiling point |
267.8°C at 760 mmHg |
| Refractive index |
1.466 |
| Flash point |
115.8°C |
| Vapour Pressur |
0.00228mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
