ChemNet > CAS > 21880-87-5 (S)-1,2,3,4-Tetrahydro-2-naphthylamine
21880-87-5 (S)-1,2,3,4-Tetrahydro-2-naphthylamine
| product Name |
(S)-1,2,3,4-Tetrahydro-2-naphthylamine |
| CAS No |
21880-87-5 |
| Synonyms |
(S)-2-Amino-1,2,3,4-tetrahydronaphthalene; (S)-1-Aminotetraline; (S)-2-Aminotetralin; (1S)-1,2,3,4-tetrahydronaphthalen-1-amine; (2S)-1,2,3,4-tetrahydronaphthalen-2-amine |
| Molecular Formula |
C10H13N |
| Molecular Weight |
147.2169 |
| InChI |
InChI=1/C10H13N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10H,5-7,11H2/t10-/m0/s1 |
| Molecular Structure |
|
| Density |
1.024g/cm3 |
| Boiling point |
250.665°C at 760 mmHg |
| Refractive index |
1.561 |
| Flash point |
111.607°C |
| Vapour Pressur |
0.021mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
