ChemNet > CAS > 21906-32-1 3-Bromophenylacetone
21906-32-1 3-Bromophenylacetone
| product Name |
3-Bromophenylacetone |
| CAS No |
21906-32-1 |
| Synonyms |
3-bromophenylacetonone; 1-(3-bromophenyl)propan-2-one |
| Molecular Formula |
C9H9BrO |
| Molecular Weight |
213.0712 |
| InChI |
InChI=1/C9H9BrO/c1-7(11)5-8-3-2-4-9(10)6-8/h2-4,6H,5H2,1H3 |
| Molecular Structure |
|
| Density |
1.401g/cm3 |
| Boiling point |
265.7°C at 760 mmHg |
| Refractive index |
1.546 |
| Flash point |
75.9°C |
| Vapour Pressur |
0.00903mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
