ChemNet > CAS > 2198-53-0 2',6'-Dimethylacetanilide
2198-53-0 2',6'-Dimethylacetanilide
| product Name |
2',6'-Dimethylacetanilide |
| Synonyms |
2,6-Acetoxylidide; N-(2,6-Dimethylphenyl)acetamide |
| Molecular Formula |
C10H13NO |
| Molecular Weight |
163.2163 |
| InChI |
InChI=1/C10H13NO/c1-7-5-4-6-8(2)10(7)11-9(3)12/h4-6H,1-3H3,(H,11,12) |
| CAS Registry Number |
2198-53-0 |
| EINECS |
218-596-8 |
| Molecular Structure |
|
| Density |
1.052g/cm3 |
| Melting point |
178-184℃ |
| Boiling point |
282.6°C at 760 mmHg |
| Refractive index |
1.56 |
| Flash point |
163°C |
| Vapour Pressur |
0.00332mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
2',6'-Dimethylacetanilide Material Safety Data Sheet
|
|
