ChemNet > CAS > 2199-46-4 Ethyl 3,4,5-trimethylpyrrole-2-carboxylate
2199-46-4 Ethyl 3,4,5-trimethylpyrrole-2-carboxylate
| product Name |
Ethyl 3,4,5-trimethylpyrrole-2-carboxylate |
| CAS No |
2199-46-4 |
| Synonyms |
3,4,5-Trimethylpyrrole-2-carboxylic acid ethyl ester; ethyl 3,4,5-trimethyl-1H-pyrrole-2-carboxylate |
| Molecular Formula |
C10H15NO2 |
| Molecular Weight |
181.2316 |
| InChI |
InChI=1/C10H15NO2/c1-5-13-10(12)9-7(3)6(2)8(4)11-9/h11H,5H2,1-4H3 |
| Molecular Structure |
|
| Density |
1.059g/cm3 |
| Boiling point |
298.1°C at 760 mmHg |
| Refractive index |
1.515 |
| Flash point |
134.1°C |
| Vapour Pressur |
0.00129mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
