ChemNet > CAS > 2199-47-5 ethyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2199-47-5 ethyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
| product Name |
ethyl 4-ethyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| CAS No |
2199-47-5 |
| Synonyms |
3,5-Dimethyl-4-ethyl-1H-pyrrole-2-carboxylic acid ethyl ester |
| Molecular Formula |
C11H17NO2 |
| Molecular Weight |
195.2582 |
| InChI |
InChI=1/C11H17NO2/c1-5-9-7(3)10(12-8(9)4)11(13)14-6-2/h12H,5-6H2,1-4H3 |
| Molecular Structure |
|
| Density |
1.041g/cm3 |
| Melting point |
87℃ |
| Boiling point |
306.7°C at 760 mmHg |
| Refractive index |
1.512 |
| Flash point |
139.3°C |
| Vapour Pressur |
0.000758mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
