ChemNet > CAS > 2199-64-6 ethyl 4-formyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2199-64-6 ethyl 4-formyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
| product Name |
ethyl 4-formyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| CAS No |
2199-64-6 |
| Synonyms |
4-Formyl-3,5-dimethyl-1H-pyrrole-2-carboxylic acid ethyl ester |
| Molecular Formula |
C10H13NO3 |
| Molecular Weight |
195.2151 |
| InChI |
InChI=1/C10H13NO3/c1-4-14-10(13)9-6(2)8(5-12)7(3)11-9/h5,11H,4H2,1-3H3 |
| Molecular Structure |
|
| Density |
1.173g/cm3 |
| Melting point |
144℃ |
| Boiling point |
347.8°C at 760 mmHg |
| Refractive index |
1.556 |
| Flash point |
164.1°C |
| Vapour Pressur |
5.25E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
