ChemNet > CAS > 2199-86-2 6,8-dichloro-2-oxo-2H-chromene-3-carboxylic acid
2199-86-2 6,8-dichloro-2-oxo-2H-chromene-3-carboxylic acid
| product Name |
6,8-dichloro-2-oxo-2H-chromene-3-carboxylic acid |
| CAS No |
2199-86-2 |
| Molecular Formula |
C10H4Cl2O4 |
| Molecular Weight |
259.0424 |
| InChI |
InChI=1/C10H4Cl2O4/c11-5-1-4-2-6(9(13)14)10(15)16-8(4)7(12)3-5/h1-3H,(H,13,14) |
| Molecular Structure |
|
| Density |
1.712g/cm3 |
| Melting point |
198℃ |
| Boiling point |
460.7°C at 760 mmHg |
| Refractive index |
1.657 |
| Flash point |
232.4°C |
| Vapour Pressur |
2.77E-09mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
