ChemNet > CAS > 2199-91-9 3-acetyl-6,8-dichloro-2H-chromen-2-one
2199-91-9 3-acetyl-6,8-dichloro-2H-chromen-2-one
| product Name |
3-acetyl-6,8-dichloro-2H-chromen-2-one |
| CAS No |
2199-91-9 |
| Molecular Formula |
C11H6Cl2O3 |
| Molecular Weight |
257.0695 |
| InChI |
InChI=1/C11H6Cl2O3/c1-5(14)8-3-6-2-7(12)4-9(13)10(6)16-11(8)15/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
1.51g/cm3 |
| Melting point |
171℃ |
| Boiling point |
462.6°C at 760 mmHg |
| Refractive index |
1.606 |
| Flash point |
208.6°C |
| Vapour Pressur |
9.71E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
