ChemNet > CAS > 220141-73-1 3,4,5-trifluoroacetophenone
220141-73-1 3,4,5-trifluoroacetophenone
| product Name |
3,4,5-trifluoroacetophenone |
| CAS No |
220141-73-1 |
| Synonyms |
3',4',5'-Trifluoroacetophenone; 1-(3,4,5-trifluorophenyl)ethanone |
| Molecular Formula |
C8H5F3O |
| Molecular Weight |
174.1199 |
| InChI |
InChI=1/C8H5F3O/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
| Molecular Structure |
|
| Density |
1.303g/cm3 |
| Boiling point |
208.8°C at 760 mmHg |
| Refractive index |
1.455 |
| Flash point |
72.5°C |
| Vapour Pressur |
0.209mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
