ChemNet > CAS > 22034-13-5 4-bromo-2,1,3-benzothiadiazole
22034-13-5 4-bromo-2,1,3-benzothiadiazole
| product Name |
4-bromo-2,1,3-benzothiadiazole |
| CAS No |
22034-13-5 |
| Molecular Formula |
C6H3BrN2S |
| Molecular Weight |
215.0704 |
| InChI |
InChI=1/C6H3BrN2S/c7-4-2-1-3-5-6(4)9-10-8-5/h1-3H |
| Molecular Structure |
|
| Density |
1.859g/cm3 |
| Melting point |
83℃ |
| Boiling point |
272.2°C at 760 mmHg |
| Refractive index |
1.733 |
| Flash point |
118.4°C |
| Vapour Pressur |
0.0103mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
