ChemNet > CAS > 22047-88-7 2-Benzyloxyphenylacetic acid
22047-88-7 2-Benzyloxyphenylacetic acid
| product Name |
2-Benzyloxyphenylacetic acid |
| CAS No |
22047-88-7 |
| Synonyms |
[2-(phenoxymethyl)phenyl]acetic acid |
| Molecular Formula |
C15H14O3 |
| Molecular Weight |
242.2699 |
| InChI |
InChI=1/C15H14O3/c16-15(17)10-12-6-4-5-7-13(12)11-18-14-8-2-1-3-9-14/h1-9H,10-11H2,(H,16,17) |
| Molecular Structure |
|
| Density |
1.201g/cm3 |
| Boiling point |
408.9°C at 760 mmHg |
| Refractive index |
1.595 |
| Flash point |
154.1°C |
| Vapour Pressur |
2.03E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
