ChemNet > CAS > 22148-86-3 (S)-(+)-4-Phenyl-2-butanol
22148-86-3 (S)-(+)-4-Phenyl-2-butanol
| product Name |
(S)-(+)-4-Phenyl-2-butanol |
| CAS No |
22148-86-3 |
| Synonyms |
(2S)-4-phenylbutan-2-ol |
| Molecular Formula |
C10H14O |
| Molecular Weight |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-/m0/s1 |
| Molecular Structure |
|
| Density |
0.98g/cm3 |
| Boiling point |
246.1°C at 760 mmHg |
| Refractive index |
1.52 |
| Flash point |
106.2°C |
| Vapour Pressur |
0.0147mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
