ChemNet > CAS > 2216-35-5 2-Bromononane
2216-35-5 2-Bromononane
| product Name |
2-Bromononane |
| CAS No |
2216-35-5 |
| Molecular Formula |
C9H19Br |
| Molecular Weight |
207.1512 |
| InChI |
InChI=1/C9H19Br/c1-3-4-5-6-7-8-9(2)10/h9H,3-8H2,1-2H3 |
| EINECS |
218-688-8 |
| Molecular Structure |
|
| Density |
1.086g/cm3 |
| Boiling point |
212.3°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
63.5°C |
| Vapour Pressur |
0.253mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
