ChemNet > CAS > 2216-45-7 4-Methylbenzyl acetate
2216-45-7 4-Methylbenzyl acetate
| product Name |
4-Methylbenzyl acetate |
| CAS No |
2216-45-7 |
| Synonyms |
Benzenemethanol, 4-methyl-, 1-acetate; 4-06-00-03173 (Beilstein Handbook Reference); 4-Methylbenzenemethanol acetate; 4-Methylbenzyl ethanoate; AI3-20661; BRN 2046163; NSC 7001; p-Acetoxymethyltoluene; p-Methylbenzyl acetate; p-Methylbenzyl alcohol acetate; p-Tolubenzyl acetate; p-Xylene, alpha-acetoxy; p-Xylyl acetate; Benzenemethanol, 4-methyl-, acetate; Benzyl alcohol, p-methyl-, acetate (6CI,7CI,8CI) |
| Molecular Formula |
C10H12O2 |
| Molecular Weight |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8-3-5-10(6-4-8)7-12-9(2)11/h3-6H,7H2,1-2H3 |
| EINECS |
218-689-3 |
| Molecular Structure |
|
| Density |
1.035g/cm3 |
| Boiling point |
224.5°C at 760 mmHg |
| Refractive index |
1.505 |
| Flash point |
98°C |
| Vapour Pressur |
0.091mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
