ChemNet > CAS > 2216-87-7 3-Undecanone
2216-87-7 3-Undecanone
| product Name |
3-Undecanone |
| CAS No |
2216-87-7 |
| Synonyms |
Ethyl n-octyl ketone; undecan-3-one |
| Molecular Formula |
C11H22O |
| Molecular Weight |
170.2918 |
| InChI |
InChI=1/C11H22O/c1-3-5-6-7-8-9-10-11(12)4-2/h3-10H2,1-2H3 |
| EINECS |
218-700-1 |
| Molecular Structure |
|
| Density |
0.821g/cm3 |
| Boiling point |
226.9°C at 760 mmHg |
| Refractive index |
1.425 |
| Flash point |
73.2°C |
| Vapour Pressur |
0.0797mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
