ChemNet > CAS > 2217-08-5 5,5-Dipropylbarbituric acid
2217-08-5 5,5-Dipropylbarbituric acid
| product Name |
5,5-Dipropylbarbituric acid |
| CAS No |
2217-08-5 |
| Synonyms |
2,4,6(1H,3H,5H)-pyrimidinetrione, 5,5-dipropyl-; 218-706-4; 5,5-dipropylpyrimidine-2,4,6(1H,3H,5H)-trione |
| Molecular Formula |
C10H16N2O3 |
| Molecular Weight |
212.2456 |
| InChI |
InChI=1/C10H16N2O3/c1-3-5-10(6-4-2)7(13)11-9(15)12-8(10)14/h3-6H2,1-2H3,(H2,11,12,13,14,15) |
| EINECS |
218-706-4 |
| Molecular Structure |
|
| Density |
1.09g/cm3 |
| Refractive index |
1.46 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
